ChemNet > CAS > 157380-76-2 4-O-benzyl-D-galactal
157380-76-2 4-O-benzyl-D-galactal
| product Name |
4-O-benzyl-D-galactal |
| CAS No |
157380-76-2 |
| Synonyms |
2,6-anhydro-3-O-benzyl-5-deoxy-D-arabino-hex-5-enitol |
| Molecular Formula |
C13H16O4 |
| Molecular Weight |
236.2637 |
| InChI |
InChI=1/C13H16O4/c14-8-12-13(11(15)6-7-16-12)17-9-10-4-2-1-3-5-10/h1-7,11-15H,8-9H2/t11-,12-,13-/m1/s1 |
| Molecular Structure |
|
| Density |
1.25g/cm3 |
| Melting point |
101-103℃ |
| Boiling point |
413.5°C at 760 mmHg |
| Refractive index |
1.587 |
| Flash point |
203.9°C |
| Vapour Pressur |
1.4E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
